C32H38N4O3S2 — CID 6317624
6-(4-benzylpiperidin-1-yl)-1-butyl-4-methyl-2-oxo-5-[(Z)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile (PubChem CID 6317624) has the molecular formula C32H38N4O3S2 and a molecular weight of 590.82 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-1-butyl-4-methyl-2-oxo-5-[(Z)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-1-butyl-4-methyl-2-oxo-5-[(Z)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6317624 |
| Molecular Formula | C32H38N4O3S2 |
| Molecular Weight | 590.82 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-1-butyl-4-methyl-2-oxo-5-[(Z)-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCC(Cc3ccccc3)CC2)c(/C=C2\SC(=S)N(CC3CCCO3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C32H38N4O3S2/c1-3-4-14-35-29(34-15-12-24(13-16-34)18-23-9-6-5-7-10-23)26(22(2)27(20-33)30(35)37)19-28-31(38)36(32(40)41-28)21-25-11-8-17-39-25/h5-7,9-10,19,24-25H,3-4,8,11-18,21H2,1-2H3/b28-19- |
| InChIKey | OOICOUXDLXQZTR-USHMODERSA-N |
| XLogP | 5.67 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.82 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|