C20H17Cl2NO3 — CID 52644357
(E)-2-(2,6-dichlorobenzoyl)-3-(4-methoxy-3-propoxyphenyl)prop-2-enenitrile (PubChem CID 52644357) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is (E)-2-(2,6-dichlorobenzoyl)-3-(4-methoxy-3-propoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(2,6-dichlorobenzoyl)-3-(4-methoxy-3-propoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 52644357 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (E)-2-(2,6-dichlorobenzoyl)-3-(4-methoxy-3-propoxyphenyl)prop-2-enenitrile |
| SMILES | CCCOc1cc(/C=C(\C#N)C(=O)c2c(Cl)cccc2Cl)ccc1OC |
| InChI | InChI=1S/C20H17Cl2NO3/c1-3-9-26-18-11-13(7-8-17(18)25-2)10-14(12-23)20(24)19-15(21)5-4-6-16(19)22/h4-8,10-11H,3,9H2,1-2H3/b14-10+ |
| InChIKey | WGUODCXJLYMPEB-GXDHUFHOSA-N |
| XLogP | 5.58 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|