C26H27ClN4O2S2 — CID 5264916
5-[[3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-ethyl-4-methyl-6-(3-methylpiperidin-1-yl)-2-oxopyridine-3-carbonitrile (PubChem CID 5264916) has the molecular formula C26H27ClN4O2S2 and a molecular weight of 527.12 g/mol. Its IUPAC name is 5-[[3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-ethyl-4-methyl-6-(3-methylpiperidin-1-yl)-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[[3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-ethyl-4-methyl-6-(3-methylpiperidin-1-yl)-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5264916 |
| Molecular Formula | C26H27ClN4O2S2 |
| Molecular Weight | 527.12 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 5-[[3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-ethyl-4-methyl-6-(3-methylpiperidin-1-yl)-2-oxopyridine-3-carbonitrile |
| SMILES | CCn1c(N2CCCC(C)C2)c(C=C2SC(=S)N(Cc3ccccc3Cl)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C26H27ClN4O2S2/c1-4-30-23(29-11-7-8-16(2)14-29)19(17(3)20(13-28)24(30)32)12-22-25(33)31(26(34)35-22)15-18-9-5-6-10-21(18)27/h5-6,9-10,12,16H,4,7-8,11,14-15H2,1-3H3 |
| InChIKey | ODQFSRKUCILEBC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|