C29H33ClN4O2S2 — CID 5266790
1-butyl-5-[[3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(3,5-dimethylpiperidin-1-yl)-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 5266790) has the molecular formula C29H33ClN4O2S2 and a molecular weight of 569.20 g/mol. Its IUPAC name is 1-butyl-5-[[3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(3,5-dimethylpiperidin-1-yl)-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[[3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(3,5-dimethylpiperidin-1-yl)-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5266790 |
| Molecular Formula | C29H33ClN4O2S2 |
| Molecular Weight | 569.20 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 1-butyl-5-[[3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(3,5-dimethylpiperidin-1-yl)-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CC(C)CC(C)C2)c(C=C2SC(=S)N(Cc3ccccc3Cl)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C29H33ClN4O2S2/c1-5-6-11-33-26(32-15-18(2)12-19(3)16-32)22(20(4)23(14-31)27(33)35)13-25-28(36)34(29(37)38-25)17-21-9-7-8-10-24(21)30/h7-10,13,18-19H,5-6,11-12,15-17H2,1-4H3 |
| InChIKey | VCQPLMQPVJIKOS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.20 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|