C28H38N4O4S2 — CID 6317793
6-[(5Z)-5-[[1-butyl-5-cyano-2-(3,5-dimethylpiperidin-1-yl)-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 6317793) has the molecular formula C28H38N4O4S2 and a molecular weight of 558.77 g/mol. Its IUPAC name is 6-[(5Z)-5-[[1-butyl-5-cyano-2-(3,5-dimethylpiperidin-1-yl)-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[1-butyl-5-cyano-2-(3,5-dimethylpiperidin-1-yl)-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 6317793 |
| Molecular Formula | C28H38N4O4S2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 6-[(5Z)-5-[[1-butyl-5-cyano-2-(3,5-dimethylpiperidin-1-yl)-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CCCCn1c(N2CC(C)CC(C)C2)c(/C=C2\SC(=S)N(CCCCCC(=O)O)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C28H38N4O4S2/c1-5-6-11-31-25(30-16-18(2)13-19(3)17-30)21(20(4)22(15-29)26(31)35)14-23-27(36)32(28(37)38-23)12-9-7-8-10-24(33)34/h14,18-19H,5-13,16-17H2,1-4H3,(H,33,34)/b23-14- |
| InChIKey | YGPUJDGZWRREMW-UCQKPKSFSA-N |
| XLogP | 5.16 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|