C27H36N4O4S2 — CID 5265830
6-[5-[[5-cyano-2-(3,5-dimethylpiperidin-1-yl)-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 5265830) has the molecular formula C27H36N4O4S2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 6-[5-[[5-cyano-2-(3,5-dimethylpiperidin-1-yl)-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[5-[[5-cyano-2-(3,5-dimethylpiperidin-1-yl)-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 5265830 |
| Molecular Formula | C27H36N4O4S2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 6-[5-[[5-cyano-2-(3,5-dimethylpiperidin-1-yl)-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CCCn1c(N2CC(C)CC(C)C2)c(C=C2SC(=S)N(CCCCCC(=O)O)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C27H36N4O4S2/c1-5-10-30-24(29-15-17(2)12-18(3)16-29)20(19(4)21(14-28)25(30)34)13-22-26(35)31(27(36)37-22)11-8-6-7-9-23(32)33/h13,17-18H,5-12,15-16H2,1-4H3,(H,32,33) |
| InChIKey | WGLCVXVEJJNSAP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|