C28H40N4O3S2 — CID 23430141
6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-1-propylpyridine-3-carbonitrile (PubChem CID 23430141) has the molecular formula C28H40N4O3S2 and a molecular weight of 544.79 g/mol. Its IUPAC name is 6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-1-propylpyridine-3-carbonitrile.
| Compound Name | 6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23430141 |
| Molecular Formula | C28H40N4O3S2 |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-1-propylpyridine-3-carbonitrile |
| SMILES | CCCCCCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CCC)c2N2CC(C)OC(C)C2)SC1=S |
| InChI | InChI=1S/C28H40N4O3S2/c1-6-8-9-10-11-12-14-32-27(34)24(37-28(32)36)15-22-21(5)23(16-29)26(33)31(13-7-2)25(22)30-17-19(3)35-20(4)18-30/h15,19-20H,6-14,17-18H2,1-5H3/b24-15+ |
| InChIKey | FERVLZZOWKOTTD-BUVRLJJBSA-N |
| XLogP | 5.61 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|