C26H36N4O4S2 — CID 6318192
1-butyl-6-(2,6-dimethylmorpholin-4-yl)-5-[(Z)-[3-(3-ethoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 6318192) has the molecular formula C26H36N4O4S2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-5-[(Z)-[3-(3-ethoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-5-[(Z)-[3-(3-ethoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6318192 |
| Molecular Formula | C26H36N4O4S2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-5-[(Z)-[3-(3-ethoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CC(C)OC(C)C2)c(/C=C2\SC(=S)N(CCCOCC)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C26H36N4O4S2/c1-6-8-10-29-23(28-15-17(3)34-18(4)16-28)20(19(5)21(14-27)24(29)31)13-22-25(32)30(26(35)36-22)11-9-12-33-7-2/h13,17-18H,6-12,15-16H2,1-5H3/b22-13- |
| InChIKey | IZYRLOPBSIFCDE-XKZIYDEJSA-N |
| XLogP | 4.07 |
| TPSA | 87.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|