C29H34N4O3S2 — CID 23430795
1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile (PubChem CID 23430795) has the molecular formula C29H34N4O3S2 and a molecular weight of 550.75 g/mol. Its IUPAC name is 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile.
| Compound Name | 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23430795 |
| Molecular Formula | C29H34N4O3S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CC(C)OC(C)C2)c(/C=C2/SC(=S)N(CCc3ccccc3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C29H34N4O3S2/c1-5-6-13-32-26(31-17-19(2)36-20(3)18-31)23(21(4)24(16-30)27(32)34)15-25-28(35)33(29(37)38-25)14-12-22-10-8-7-9-11-22/h7-11,15,19-20H,5-6,12-14,17-18H2,1-4H3/b25-15+ |
| InChIKey | KZHCKQNURXMOSH-MFKUBSTISA-N |
| XLogP | 4.89 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|