C22H28N4O3S2 — CID 23430781
1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile (PubChem CID 23430781) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23430781 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CC(C)OC(C)C2)c(/C=C2/SC(=S)N(C)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C22H28N4O3S2/c1-6-7-8-26-19(25-11-13(2)29-14(3)12-25)16(15(4)17(10-23)20(26)27)9-18-21(28)24(5)22(30)31-18/h9,13-14H,6-8,11-12H2,1-5H3/b18-9+ |
| InChIKey | VWQNLZOEBLZVLZ-GIJQJNRQSA-N |
| XLogP | 3.27 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|