C25H34N4O3S2 — CID 6318147
1-butyl-5-[(Z)-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 6318147) has the molecular formula C25H34N4O3S2 and a molecular weight of 502.71 g/mol. Its IUPAC name is 1-butyl-5-[(Z)-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(Z)-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6318147 |
| Molecular Formula | C25H34N4O3S2 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 1-butyl-5-[(Z)-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2,6-dimethylmorpholin-4-yl)-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCN1C(=O)/C(=C/c2c(C)c(C#N)c(=O)n(CCCC)c2N2CC(C)OC(C)C2)SC1=S |
| InChI | InChI=1S/C25H34N4O3S2/c1-6-8-10-28-22(27-14-16(3)32-17(4)15-27)19(18(5)20(13-26)23(28)30)12-21-24(31)29(11-9-7-2)25(33)34-21/h12,16-17H,6-11,14-15H2,1-5H3/b21-12- |
| InChIKey | BSTGQMGDHNUPLG-MTJSOVHGSA-N |
| XLogP | 4.44 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|