C29H42N4O3S2 — CID 6318153
1-butyl-6-(2,6-dimethylmorpholin-4-yl)-5-[(Z)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 6318153) has the molecular formula C29H42N4O3S2 and a molecular weight of 558.81 g/mol. Its IUPAC name is 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-5-[(Z)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-5-[(Z)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6318153 |
| Molecular Formula | C29H42N4O3S2 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 1-butyl-6-(2,6-dimethylmorpholin-4-yl)-5-[(Z)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCC(CC)CN1C(=O)/C(=C/c2c(C)c(C#N)c(=O)n(CCCC)c2N2CC(C)OC(C)C2)SC1=S |
| InChI | InChI=1S/C29H42N4O3S2/c1-7-10-12-22(9-3)18-33-28(35)25(38-29(33)37)14-23-21(6)24(15-30)27(34)32(13-11-8-2)26(23)31-16-19(4)36-20(5)17-31/h14,19-20,22H,7-13,16-18H2,1-6H3/b25-14- |
| InChIKey | FKVFBSAOKYUNAJ-QFEZKATASA-N |
| XLogP | 5.86 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|