C21H27N5O2S2 — CID 6317545
1-butyl-4-methyl-5-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile (PubChem CID 6317545) has the molecular formula C21H27N5O2S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-butyl-4-methyl-5-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-4-methyl-5-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6317545 |
| Molecular Formula | C21H27N5O2S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-butyl-4-methyl-5-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCN(C)CC2)c(/C=C2\SC(=S)N(C)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C21H27N5O2S2/c1-5-6-7-26-18(25-10-8-23(3)9-11-25)15(14(2)16(13-22)19(26)27)12-17-20(28)24(4)21(29)30-17/h12H,5-11H2,1-4H3/b17-12- |
| InChIKey | PDTAHTJPBNLHIF-ATVHPVEESA-N |
| XLogP | 2.41 |
| TPSA | 72.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|