C26H28N4O2S2 — CID 6317398
5-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-butyl-4-methyl-2-oxo-6-pyrrolidin-1-ylpyridine-3-carbonitrile (PubChem CID 6317398) has the molecular formula C26H28N4O2S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is 5-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-butyl-4-methyl-2-oxo-6-pyrrolidin-1-ylpyridine-3-carbonitrile.
| Compound Name | 5-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-butyl-4-methyl-2-oxo-6-pyrrolidin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6317398 |
| Molecular Formula | C26H28N4O2S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 5-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-butyl-4-methyl-2-oxo-6-pyrrolidin-1-ylpyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCCC2)c(/C=C2\SC(=S)N(Cc3ccccc3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C26H28N4O2S2/c1-3-4-14-29-23(28-12-8-9-13-28)20(18(2)21(16-27)24(29)31)15-22-25(32)30(26(33)34-22)17-19-10-6-5-7-11-19/h5-7,10-11,15H,3-4,8-9,12-14,17H2,1-2H3/b22-15- |
| InChIKey | UOFNLVPIRNIRPC-JCMHNJIXSA-N |
| XLogP | 4.83 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|