C28H32N4O3S2 — CID 23430244
1-butyl-5-[(E)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile (PubChem CID 23430244) has the molecular formula C28H32N4O3S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 1-butyl-5-[(E)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(E)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23430244 |
| Molecular Formula | C28H32N4O3S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 1-butyl-5-[(E)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCCCC2)c(/C=C2/SC(=S)N(Cc3ccc(OC)cc3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C28H32N4O3S2/c1-4-5-15-31-25(30-13-7-6-8-14-30)22(19(2)23(17-29)26(31)33)16-24-27(34)32(28(36)37-24)18-20-9-11-21(35-3)12-10-20/h9-12,16H,4-8,13-15,18H2,1-3H3/b24-16+ |
| InChIKey | AFJVEMASCAIQLA-LFVJCYFKSA-N |
| XLogP | 5.23 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|