C22H29N5O2S2 — CID 5265532
5-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(4-ethylpiperazin-1-yl)-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile (PubChem CID 5265532) has the molecular formula C22H29N5O2S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is 5-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(4-ethylpiperazin-1-yl)-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile.
| Compound Name | 5-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(4-ethylpiperazin-1-yl)-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5265532 |
| Molecular Formula | C22H29N5O2S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 5-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(4-ethylpiperazin-1-yl)-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(N2CCN(CC)CC2)c(C=C2SC(=S)N(CC)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C22H29N5O2S2/c1-5-8-27-19(25-11-9-24(6-2)10-12-25)16(15(4)17(14-23)20(27)28)13-18-21(29)26(7-3)22(30)31-18/h13H,5-12H2,1-4H3 |
| InChIKey | BDWWQDWOQRHMRL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|