C21H27N5O3S2 — CID 3355086
1-ethyl-5-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[4-(2-hydroxyethyl)piperazin-1-yl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 3355086) has the molecular formula C21H27N5O3S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 1-ethyl-5-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[4-(2-hydroxyethyl)piperazin-1-yl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-ethyl-5-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[4-(2-hydroxyethyl)piperazin-1-yl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3355086 |
| Molecular Formula | C21H27N5O3S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-ethyl-5-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[4-(2-hydroxyethyl)piperazin-1-yl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(CC)c2N2CCN(CCO)CC2)SC1=S |
| InChI | InChI=1S/C21H27N5O3S2/c1-4-25-18(24-8-6-23(7-9-24)10-11-27)15(14(3)16(13-22)19(25)28)12-17-20(29)26(5-2)21(30)31-17/h12,27H,4-11H2,1-3H3 |
| InChIKey | XMMWJNHIKXAEHX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|