C24H32N4O3S2 — CID 5266251
1-butyl-4-methyl-6-morpholin-4-yl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile (PubChem CID 5266251) has the molecular formula C24H32N4O3S2 and a molecular weight of 488.68 g/mol. Its IUPAC name is 1-butyl-4-methyl-6-morpholin-4-yl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile.
| Compound Name | 1-butyl-4-methyl-6-morpholin-4-yl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5266251 |
| Molecular Formula | C24H32N4O3S2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 1-butyl-4-methyl-6-morpholin-4-yl-2-oxo-5-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
| SMILES | CCCCCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(CCCC)c2N2CCOCC2)SC1=S |
| InChI | InChI=1S/C24H32N4O3S2/c1-4-6-8-10-28-23(30)20(33-24(28)32)15-18-17(3)19(16-25)22(29)27(9-7-5-2)21(18)26-11-13-31-14-12-26/h15H,4-14H2,1-3H3 |
| InChIKey | AVRCNDIIQCJEBX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|