C14H12Cl2N2O3S — CID 52670529
ethyl N-[[5-(3,5-dichlorophenyl)thiophene-2-carbonyl]amino]carbamate (PubChem CID 52670529) has the molecular formula C14H12Cl2N2O3S and a molecular weight of 359.23 g/mol. Its IUPAC name is ethyl N-[[5-(3,5-dichlorophenyl)thiophene-2-carbonyl]amino]carbamate.
| Compound Name | ethyl N-[[5-(3,5-dichlorophenyl)thiophene-2-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 52670529 |
| Molecular Formula | C14H12Cl2N2O3S |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | ethyl N-[[5-(3,5-dichlorophenyl)thiophene-2-carbonyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1ccc(-c2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C14H12Cl2N2O3S/c1-2-21-14(20)18-17-13(19)12-4-3-11(22-12)8-5-9(15)7-10(16)6-8/h3-7H,2H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | OMRGGLZGJLFLSF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|