C12H15F2N3O2 — CID 52685012
N-carbamoyl-2-[(2,6-difluorophenyl)methyl-ethylamino]acetamide (PubChem CID 52685012) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is N-carbamoyl-2-[(2,6-difluorophenyl)methyl-ethylamino]acetamide.
| Compound Name | N-carbamoyl-2-[(2,6-difluorophenyl)methyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 52685012 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-carbamoyl-2-[(2,6-difluorophenyl)methyl-ethylamino]acetamide |
| SMILES | CCN(CC(=O)NC(N)=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H15F2N3O2/c1-2-17(7-11(18)16-12(15)19)6-8-9(13)4-3-5-10(8)14/h3-5H,2,6-7H2,1H3,(H3,15,16,18,19) |
| InChIKey | MANZYHSJNUOGCK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |