C20H22F3N3O4 — CID 52690735
2-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl-methylamino]-N-(2-nitrophenyl)acetamide (PubChem CID 52690735) has the molecular formula C20H22F3N3O4 and a molecular weight of 425.41 g/mol. Its IUPAC name is 2-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl-methylamino]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl-methylamino]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 52690735 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl-methylamino]-N-(2-nitrophenyl)acetamide |
| SMILES | Cc1cc(CN(C)CC(=O)Nc2ccccc2[N+](=O)[O-])cc(C)c1OCC(F)(F)F |
| InChI | InChI=1S/C20H22F3N3O4/c1-13-8-15(9-14(2)19(13)30-12-20(21,22)23)10-25(3)11-18(27)24-16-6-4-5-7-17(16)26(28)29/h4-9H,10-12H2,1-3H3,(H,24,27) |
| InChIKey | KBUWLPDTLPNMSL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|