C21H23ClF3N3O3 — CID 52690938
2-chloro-N'-[2-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl-methylamino]acetyl]benzohydrazide (PubChem CID 52690938) has the molecular formula C21H23ClF3N3O3 and a molecular weight of 457.88 g/mol. Its IUPAC name is 2-chloro-N'-[2-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl-methylamino]acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl-methylamino]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 52690938 |
| Molecular Formula | C21H23ClF3N3O3 |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 2-chloro-N'-[2-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl-methylamino]acetyl]benzohydrazide |
| SMILES | Cc1cc(CN(C)CC(=O)NNC(=O)c2ccccc2Cl)cc(C)c1OCC(F)(F)F |
| InChI | InChI=1S/C21H23ClF3N3O3/c1-13-8-15(9-14(2)19(13)31-12-21(23,24)25)10-28(3)11-18(29)26-27-20(30)16-6-4-5-7-17(16)22/h4-9H,10-12H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | WDBPVOMTKYYVCE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|