C29H26N4O5S — CID 5269466
prop-2-enyl 2-[2-(4-ethylphenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5269466) has the molecular formula C29H26N4O5S and a molecular weight of 542.62 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(4-ethylphenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(4-ethylphenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5269466 |
| Molecular Formula | C29H26N4O5S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | prop-2-enyl 2-[2-(4-ethylphenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3c(C)nc4ccccn34)C2c2ccc(CC)cc2)nc1C |
| InChI | InChI=1S/C29H26N4O5S/c1-5-15-38-28(37)26-17(4)31-29(39-26)33-23(19-12-10-18(6-2)11-13-19)21(25(35)27(33)36)24(34)22-16(3)30-20-9-7-8-14-32(20)22/h5,7-14,23,34H,1,6,15H2,2-4H3 |
| InChIKey | STJJJYDZCADQBQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|