C27H20Cl2N4O5S — CID 5269455
prop-2-enyl 2-[2-(3,4-dichlorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5269455) has the molecular formula C27H20Cl2N4O5S and a molecular weight of 583.45 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(3,4-dichlorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(3,4-dichlorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5269455 |
| Molecular Formula | C27H20Cl2N4O5S |
| Molecular Weight | 583.45 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | prop-2-enyl 2-[2-(3,4-dichlorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3c(C)nc4ccccn34)C2c2ccc(Cl)c(Cl)c2)nc1C |
| InChI | InChI=1S/C27H20Cl2N4O5S/c1-4-11-38-26(37)24-14(3)31-27(39-24)33-21(15-8-9-16(28)17(29)12-15)19(23(35)25(33)36)22(34)20-13(2)30-18-7-5-6-10-32(18)20/h4-10,12,21,34H,1,11H2,2-3H3 |
| InChIKey | FEZMHIQBEMBNOB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|