C25H18Cl2N4O5S — CID 5269355
methyl 2-[2-(3,4-dichlorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5269355) has the molecular formula C25H18Cl2N4O5S and a molecular weight of 557.42 g/mol. Its IUPAC name is methyl 2-[2-(3,4-dichlorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[2-(3,4-dichlorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5269355 |
| Molecular Formula | C25H18Cl2N4O5S |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | methyl 2-[2-(3,4-dichlorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3c(C)nc4ccccn34)C2c2ccc(Cl)c(Cl)c2)nc1C |
| InChI | InChI=1S/C25H18Cl2N4O5S/c1-11-18(30-9-5-4-6-16(30)28-11)20(32)17-19(13-7-8-14(26)15(27)10-13)31(23(34)21(17)33)25-29-12(2)22(37-25)24(35)36-3/h4-10,19,32H,1-3H3 |
| InChIKey | CGXXRYDWBKAMIT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|