C25H19FN4O5S — CID 5269380
methyl 2-[2-(2-fluorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5269380) has the molecular formula C25H19FN4O5S and a molecular weight of 506.52 g/mol. Its IUPAC name is methyl 2-[2-(2-fluorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[2-(2-fluorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5269380 |
| Molecular Formula | C25H19FN4O5S |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | methyl 2-[2-(2-fluorophenyl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3c(C)nc4ccccn34)C2c2ccccc2F)nc1C |
| InChI | InChI=1S/C25H19FN4O5S/c1-12-18(29-11-7-6-10-16(29)27-12)20(31)17-19(14-8-4-5-9-15(14)26)30(23(33)21(17)32)25-28-13(2)22(36-25)24(34)35-3/h4-11,19,31H,1-3H3 |
| InChIKey | SBUDSSAGTAILOW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|