C21H18FN3O5S — CID 52699326
ethyl 3-[[5-[(2-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]carbamoyl]-5-nitrobenzoate (PubChem CID 52699326) has the molecular formula C21H18FN3O5S and a molecular weight of 443.46 g/mol. Its IUPAC name is ethyl 3-[[5-[(2-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]carbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[[5-[(2-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 52699326 |
| Molecular Formula | C21H18FN3O5S |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | ethyl 3-[[5-[(2-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]carbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2nc(C)c(Cc3ccccc3F)s2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18FN3O5S/c1-3-30-20(27)15-8-14(9-16(10-15)25(28)29)19(26)24-21-23-12(2)18(31-21)11-13-6-4-5-7-17(13)22/h4-10H,3,11H2,1-2H3,(H,23,24,26) |
| InChIKey | LJCRKOMQXJVXQX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|