C20H19Cl2N3O5 — CID 52701024
N-[(3,4-dichlorophenyl)methyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-propan-2-ylacetamide (PubChem CID 52701024) has the molecular formula C20H19Cl2N3O5 and a molecular weight of 452.29 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-propan-2-ylacetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 52701024 |
| Molecular Formula | C20H19Cl2N3O5 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN1C(=O)COc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H19Cl2N3O5/c1-12(2)23(9-13-3-5-15(21)16(22)7-13)19(26)10-24-17-8-14(25(28)29)4-6-18(17)30-11-20(24)27/h3-8,12H,9-11H2,1-2H3 |
| InChIKey | HJBSVDAMAGBLSS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|