C34H34N4O6S — CID 5270135
1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 5270135) has the molecular formula C34H34N4O6S and a molecular weight of 626.74 g/mol. Its IUPAC name is 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5270135 |
| Molecular Formula | C34H34N4O6S |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc2nc(N3C(=O)C(=O)C(=C(O)c4c(C)nc5ccccn45)C3c3ccc(OCCC(C)C)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C34H34N4O6S/c1-6-43-22-11-12-23-26(18-22)45-34(36-23)38-30(21-10-13-24(25(17-21)42-5)44-16-14-19(2)3)28(32(40)33(38)41)31(39)29-20(4)35-27-9-7-8-15-37(27)29/h7-13,15,17-19,30,39H,6,14,16H2,1-5H3 |
| InChIKey | WNMVFGPARRJHIG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|