C29H27N3O3 — CID 52703335
N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-2-phenylquinoline-4-carboxamide (PubChem CID 52703335) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 52703335 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(COc1ccc(CCNC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1)NC1CC1 |
| InChI | InChI=1S/C29H27N3O3/c33-28(31-22-12-13-22)19-35-23-14-10-20(11-15-23)16-17-30-29(34)25-18-27(21-6-2-1-3-7-21)32-26-9-5-4-8-24(25)26/h1-11,14-15,18,22H,12-13,16-17,19H2,(H,30,34)(H,31,33) |
| InChIKey | KNZAOUDZRGCFTC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |