C19H18BrN3O3 — CID 52706130
(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-[4-(cyclopropylamino)-3-nitrophenyl]methanone (PubChem CID 52706130) has the molecular formula C19H18BrN3O3 and a molecular weight of 416.28 g/mol. Its IUPAC name is (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-[4-(cyclopropylamino)-3-nitrophenyl]methanone.
| Compound Name | (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-[4-(cyclopropylamino)-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 52706130 |
| Molecular Formula | C19H18BrN3O3 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (6-bromo-3,4-dihydro-2H-quinolin-1-yl)-[4-(cyclopropylamino)-3-nitrophenyl]methanone |
| SMILES | O=C(c1ccc(NC2CC2)c([N+](=O)[O-])c1)N1CCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C19H18BrN3O3/c20-14-4-8-17-12(10-14)2-1-9-22(17)19(24)13-3-7-16(21-15-5-6-15)18(11-13)23(25)26/h3-4,7-8,10-11,15,21H,1-2,5-6,9H2 |
| InChIKey | CHJJMVOGXGVBJW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|