C18H22N2O4 — CID 5271079
ethyl (E,4S)-7-amino-7-oxo-4-[[(E)-3-phenylprop-2-enoyl]amino]hept-2-enoate (PubChem CID 5271079) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-7-oxo-4-[[(E)-3-phenylprop-2-enoyl]amino]hept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-7-oxo-4-[[(E)-3-phenylprop-2-enoyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 5271079 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl (E,4S)-7-amino-7-oxo-4-[[(E)-3-phenylprop-2-enoyl]amino]hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c1-2-24-18(23)13-10-15(9-11-16(19)21)20-17(22)12-8-14-6-4-3-5-7-14/h3-8,10,12-13,15H,2,9,11H2,1H3,(H2,19,21)(H,20,22)/b12-8+,13-10+/t15-/m0/s1 |
| InChIKey | OBWMKJGUXRTZKB-IEBOVWRXSA-N |
| XLogP | 1.57 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|