C22H31NO5 — CID 5271180
methyl 2-[6-(3,5-diethyl-1,2-oxazol-4-yl)hexoxy]-5-methoxybenzoate (PubChem CID 5271180) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is methyl 2-[6-(3,5-diethyl-1,2-oxazol-4-yl)hexoxy]-5-methoxybenzoate.
| Compound Name | methyl 2-[6-(3,5-diethyl-1,2-oxazol-4-yl)hexoxy]-5-methoxybenzoate |
|---|---|
| PubChem CID | 5271180 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | methyl 2-[6-(3,5-diethyl-1,2-oxazol-4-yl)hexoxy]-5-methoxybenzoate |
| SMILES | CCc1noc(CC)c1CCCCCCOc1ccc(OC)cc1C(=O)OC |
| InChI | InChI=1S/C22H31NO5/c1-5-19-17(20(6-2)28-23-19)11-9-7-8-10-14-27-21-13-12-16(25-3)15-18(21)22(24)26-4/h12-13,15H,5-11,14H2,1-4H3 |
| InChIKey | JCEXBKPJQCGGJI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|