C13H13NO4 — CID 706052
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoic acid (PubChem CID 706052) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoic acid.
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 706052 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoic acid |
| SMILES | Cc1noc(C)c1COc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H13NO4/c1-8-12(9(2)18-14-8)7-17-11-5-3-10(4-6-11)13(15)16/h3-6H,7H2,1-2H3,(H,15,16) |
| InChIKey | FZZOXUGENAQGIJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |