C11H13BrFIN2O5 — CID 5271699
5-(1-bromo-2-fluoro-2-iodoethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 5271699) has the molecular formula C11H13BrFIN2O5 and a molecular weight of 479.04 g/mol. Its IUPAC name is 5-(1-bromo-2-fluoro-2-iodoethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(1-bromo-2-fluoro-2-iodoethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5271699 |
| Molecular Formula | C11H13BrFIN2O5 |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 477.90 |
| IUPAC Name | 5-(1-bromo-2-fluoro-2-iodoethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1C(Br)C(F)I |
| InChI | InChI=1S/C11H13BrFIN2O5/c12-8(9(13)14)4-2-16(11(20)15-10(4)19)7-1-5(18)6(3-17)21-7/h2,5-9,17-18H,1,3H2,(H,15,19,20)/t5-,6+,7+,8?,9?/m0/s1 |
| InChIKey | PKYRZJJUQXJNET-ALWYUHRNSA-N |
| XLogP | 0.34 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|