C20H21FN2O2 — CID 52725585
N-(1-butanoyl-3,4-dihydro-2H-quinolin-5-yl)-4-fluorobenzamide (PubChem CID 52725585) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is N-(1-butanoyl-3,4-dihydro-2H-quinolin-5-yl)-4-fluorobenzamide.
| Compound Name | N-(1-butanoyl-3,4-dihydro-2H-quinolin-5-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 52725585 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-(1-butanoyl-3,4-dihydro-2H-quinolin-5-yl)-4-fluorobenzamide |
| SMILES | CCCC(=O)N1CCCc2c(NC(=O)c3ccc(F)cc3)cccc21 |
| InChI | InChI=1S/C20H21FN2O2/c1-2-5-19(24)23-13-4-6-16-17(7-3-8-18(16)23)22-20(25)14-9-11-15(21)12-10-14/h3,7-12H,2,4-6,13H2,1H3,(H,22,25) |
| InChIKey | YPWWBBLWIMMHFT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |