C22H25FN2O3 — CID 55977616
N-[1-(4-ethoxybutanoyl)-3,4-dihydro-2H-quinolin-5-yl]-4-fluorobenzamide (PubChem CID 55977616) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is N-[1-(4-ethoxybutanoyl)-3,4-dihydro-2H-quinolin-5-yl]-4-fluorobenzamide.
| Compound Name | N-[1-(4-ethoxybutanoyl)-3,4-dihydro-2H-quinolin-5-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 55977616 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[1-(4-ethoxybutanoyl)-3,4-dihydro-2H-quinolin-5-yl]-4-fluorobenzamide |
| SMILES | CCOCCCC(=O)N1CCCc2c(NC(=O)c3ccc(F)cc3)cccc21 |
| InChI | InChI=1S/C22H25FN2O3/c1-2-28-15-5-9-21(26)25-14-4-6-18-19(7-3-8-20(18)25)24-22(27)16-10-12-17(23)13-11-16/h3,7-8,10-13H,2,4-6,9,14-15H2,1H3,(H,24,27) |
| InChIKey | IAQZTHDPAPSWHX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|