C26H24N4O3S — CID 5272605
4-(2-amino-1,3-thiazol-4-yl)-N-[2-[benzyl-[(2-hydroxyphenyl)methyl]amino]-2-oxoethyl]benzamide (PubChem CID 5272605) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-(2-amino-1,3-thiazol-4-yl)-N-[2-[benzyl-[(2-hydroxyphenyl)methyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 4-(2-amino-1,3-thiazol-4-yl)-N-[2-[benzyl-[(2-hydroxyphenyl)methyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 5272605 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-(2-amino-1,3-thiazol-4-yl)-N-[2-[benzyl-[(2-hydroxyphenyl)methyl]amino]-2-oxoethyl]benzamide |
| SMILES | Nc1nc(-c2ccc(C(=O)NCC(=O)N(Cc3ccccc3)Cc3ccccc3O)cc2)cs1 |
| InChI | InChI=1S/C26H24N4O3S/c27-26-29-22(17-34-26)19-10-12-20(13-11-19)25(33)28-14-24(32)30(15-18-6-2-1-3-7-18)16-21-8-4-5-9-23(21)31/h1-13,17,31H,14-16H2,(H2,27,29)(H,28,33) |
| InChIKey | MHUPQZWEBQWKLN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|