C23H25Cl2N3 — CID 5274709
1-[[1,5-bis(2-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-methylpiperazine (PubChem CID 5274709) has the molecular formula C23H25Cl2N3 and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-[[1,5-bis(2-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[1,5-bis(2-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 5274709 |
| Molecular Formula | C23H25Cl2N3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 1-[[1,5-bis(2-chlorophenyl)-2-methylpyrrol-3-yl]methyl]-4-methylpiperazine |
| SMILES | Cc1c(CN2CCN(C)CC2)cc(-c2ccccc2Cl)n1-c1ccccc1Cl |
| InChI | InChI=1S/C23H25Cl2N3/c1-17-18(16-27-13-11-26(2)12-14-27)15-23(19-7-3-4-8-20(19)24)28(17)22-10-6-5-9-21(22)25/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | BZEBEIXMHRCUIL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|