C22H17Cl2NO3S — CID 5275171
3-chloro-4-[[2-[2-(2-chloro-4-methylphenyl)phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 5275171) has the molecular formula C22H17Cl2NO3S and a molecular weight of 446.36 g/mol. Its IUPAC name is 3-chloro-4-[[2-[2-(2-chloro-4-methylphenyl)phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 3-chloro-4-[[2-[2-(2-chloro-4-methylphenyl)phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 5275171 |
| Molecular Formula | C22H17Cl2NO3S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 3-chloro-4-[[2-[2-(2-chloro-4-methylphenyl)phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | Cc1ccc(-c2ccccc2SCC(=O)Nc2ccc(C(=O)O)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2NO3S/c1-13-6-8-15(17(23)10-13)16-4-2-3-5-20(16)29-12-21(26)25-19-9-7-14(22(27)28)11-18(19)24/h2-11H,12H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | DLIDWMISTXQSAF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |