C17H14Cl2N6O2S — CID 5275186
3-chloro-4-[[2-[1-(2-chloro-4-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide (PubChem CID 5275186) has the molecular formula C17H14Cl2N6O2S and a molecular weight of 437.31 g/mol. Its IUPAC name is 3-chloro-4-[[2-[1-(2-chloro-4-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | 3-chloro-4-[[2-[1-(2-chloro-4-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 5275186 |
| Molecular Formula | C17H14Cl2N6O2S |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 3-chloro-4-[[2-[1-(2-chloro-4-methylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)Nc2ccc(C(N)=O)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N6O2S/c1-9-2-5-14(12(19)6-9)25-17(22-23-24-25)28-8-15(26)21-13-4-3-10(16(20)27)7-11(13)18/h2-7H,8H2,1H3,(H2,20,27)(H,21,26) |
| InChIKey | OWRVLOSMWSSHAX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |