C21H28O6 — CID 5275229
1-[(4bS,8aS,10R)-1,10-dihydroxy-4b,8,8-trimethyl-3,4-dioxo-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]ethyl acetate (PubChem CID 5275229) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 1-[(4bS,8aS,10R)-1,10-dihydroxy-4b,8,8-trimethyl-3,4-dioxo-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]ethyl acetate.
| Compound Name | 1-[(4bS,8aS,10R)-1,10-dihydroxy-4b,8,8-trimethyl-3,4-dioxo-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 5275229 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-[(4bS,8aS,10R)-1,10-dihydroxy-4b,8,8-trimethyl-3,4-dioxo-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)C1=C(O)C2=C(C(=O)C1=O)[C@@]1(C)CCCC(C)(C)[C@@H]1C[C@H]2O |
| InChI | InChI=1S/C21H28O6/c1-10(27-11(2)22)14-17(24)15-12(23)9-13-20(3,4)7-6-8-21(13,5)16(15)19(26)18(14)25/h10,12-13,23-24H,6-9H2,1-5H3/t10?,12-,13+,21+/m1/s1 |
| InChIKey | XXLSAUHGAFIPFS-IRKRLPQMSA-N |
| XLogP | 2.80 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|