C33H33N5O2 — CID 5276107
1-cyclohexyl-2-[2-(4-piperazin-1-ylphenyl)quinolin-6-yl]benzimidazole-5-carboxylic acid (PubChem CID 5276107) has the molecular formula C33H33N5O2 and a molecular weight of 531.66 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-(4-piperazin-1-ylphenyl)quinolin-6-yl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[2-(4-piperazin-1-ylphenyl)quinolin-6-yl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 5276107 |
| Molecular Formula | C33H33N5O2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 1-cyclohexyl-2-[2-(4-piperazin-1-ylphenyl)quinolin-6-yl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccc3nc(-c4ccc(N5CCNCC5)cc4)ccc3c1)n2C1CCCCC1 |
| InChI | InChI=1S/C33H33N5O2/c39-33(40)25-10-15-31-30(21-25)36-32(38(31)27-4-2-1-3-5-27)24-9-14-29-23(20-24)8-13-28(35-29)22-6-11-26(12-7-22)37-18-16-34-17-19-37/h6-15,20-21,27,34H,1-5,16-19H2,(H,39,40) |
| InChIKey | PJDANKKKQOCTIA-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |