About 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide
5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide (PubChem CID 5276301) has the molecular formula C17H21ClN2O2
and a molecular weight of 320.82 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide.
Molecular Properties
| Compound Name | 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide |
| PubChem CID | 5276301 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide |
| SMILES | CN1C2CCC23CC[C@H](NC(=O)c2cc(Cl)ccc2O)CC13 |
| InChI | InChI=1S/C17H21ClN2O2/c1-20-14-5-7-17(14)6-4-11(9-15(17)20)19-16(22)12-8-10(18)2-3-13(12)21/h2-3,8,11,14-15,21H,4-7,9H2,1H3,(H,19,22)/t11-,14?,15?,17?/m0/s1 |
| InChIKey | RFEJTIQIAJJYDI-WFVCENDPSA-N |
| XLogP | 2.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide?
The IUPAC name of 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide (CID 5276301) is 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide.
What is the SMILES notation for 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide?
The canonical SMILES for 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide is CN1C2CCC23CC[C@H](NC(=O)c2cc(Cl)ccc2O)CC13.
What is the InChIKey of 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide?
The InChIKey is RFEJTIQIAJJYDI-WFVCENDPSA-N. The full InChI is InChI=1S/C17H21ClN2O2/c1-20-14-5-7-17(14)6-4-11(9-15(17)20)19-16(22)12-8-10(18)2-3-13(12)21/h2-3,8,11,14-15,21H,4-7,9H2,1H3,(H,19,22)/t11-,14?,15?,17?/m0/s1.
What are the key properties of 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide?
5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide has a molecular weight of 320.82 g/mol, XLogP of 2.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-hydroxy-N-[(8S)-5-methyl-5-azatricyclo[4.4.0.01,4]decan-8-yl]benzamide is sourced from PubChem (CID 5276301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).