C14H25N — CID 5276625
N-ethyl-3,5-dimethyladamantan-1-amine (PubChem CID 5276625) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyladamantan-1-amine.
| Compound Name | N-ethyl-3,5-dimethyladamantan-1-amine |
|---|---|
| PubChem CID | 5276625 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-ethyl-3,5-dimethyladamantan-1-amine |
| SMILES | CCNC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C14H25N/c1-4-15-14-7-11-5-12(2,9-14)8-13(3,6-11)10-14/h11,15H,4-10H2,1-3H3 |
| InChIKey | FTXVGNKOUJOOHU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |