C22H34N4O — CID 5276795
2-[ethyl-[2-(octylamino)-6-phenylpyrimidin-4-yl]amino]ethanol (PubChem CID 5276795) has the molecular formula C22H34N4O and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-[ethyl-[2-(octylamino)-6-phenylpyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[ethyl-[2-(octylamino)-6-phenylpyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 5276795 |
| Molecular Formula | C22H34N4O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 2-[ethyl-[2-(octylamino)-6-phenylpyrimidin-4-yl]amino]ethanol |
| SMILES | CCCCCCCCNc1nc(-c2ccccc2)cc(N(CC)CCO)n1 |
| InChI | InChI=1S/C22H34N4O/c1-3-5-6-7-8-12-15-23-22-24-20(19-13-10-9-11-14-19)18-21(25-22)26(4-2)16-17-27/h9-11,13-14,18,27H,3-8,12,15-17H2,1-2H3,(H,23,24,25) |
| InChIKey | WOTLDBDNBYGJMB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|