C20H30N2O3 — CID 52775607
tert-butyl 4-[2-(N-ethylanilino)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 52775607) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl 4-[2-(N-ethylanilino)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(N-ethylanilino)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 52775607 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl 4-[2-(N-ethylanilino)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CCN(C(=O)CC1CCN(C(=O)OC(C)(C)C)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c1-5-22(17-9-7-6-8-10-17)18(23)15-16-11-13-21(14-12-16)19(24)25-20(2,3)4/h6-10,16H,5,11-15H2,1-4H3 |
| InChIKey | NYEQLZJLHCTTGI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |