C25H29FN2O5 — CID 5278531
(3Z,5S)-3-[(2-fluorophenyl)methylidene]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione (PubChem CID 5278531) has the molecular formula C25H29FN2O5 and a molecular weight of 456.51 g/mol. Its IUPAC name is (3Z,5S)-3-[(2-fluorophenyl)methylidene]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione.
| Compound Name | (3Z,5S)-3-[(2-fluorophenyl)methylidene]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 5278531 |
| Molecular Formula | C25H29FN2O5 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (3Z,5S)-3-[(2-fluorophenyl)methylidene]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione |
| SMILES | COCON1C(=O)/C(=C/c2ccccc2F)N(Cc2ccc(OC)cc2)[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C25H29FN2O5/c1-17(2)13-22-24(29)28(33-16-31-3)25(30)23(14-19-7-5-6-8-21(19)26)27(22)15-18-9-11-20(32-4)12-10-18/h5-12,14,17,22H,13,15-16H2,1-4H3/b23-14-/t22-/m0/s1 |
| InChIKey | WSRIJBDBRXESEL-MQXJPVLKSA-N |
| XLogP | 4.00 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|