C28H27FN2O5 — CID 5278534
(3S,5Z)-3-benzyl-5-[(4-fluorophenyl)methylidene]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]piperazine-2,6-dione (PubChem CID 5278534) has the molecular formula C28H27FN2O5 and a molecular weight of 490.53 g/mol. Its IUPAC name is (3S,5Z)-3-benzyl-5-[(4-fluorophenyl)methylidene]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]piperazine-2,6-dione.
| Compound Name | (3S,5Z)-3-benzyl-5-[(4-fluorophenyl)methylidene]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 5278534 |
| Molecular Formula | C28H27FN2O5 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (3S,5Z)-3-benzyl-5-[(4-fluorophenyl)methylidene]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]piperazine-2,6-dione |
| SMILES | COCON1C(=O)/C(=C/c2ccc(F)cc2)N(Cc2ccc(OC)cc2)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H27FN2O5/c1-34-19-36-31-27(32)25(16-20-6-4-3-5-7-20)30(18-22-10-14-24(35-2)15-11-22)26(28(31)33)17-21-8-12-23(29)13-9-21/h3-15,17,25H,16,18-19H2,1-2H3/b26-17-/t25-/m0/s1 |
| InChIKey | QFTPLYHAALVCDM-BPTDDQHESA-N |
| XLogP | 4.19 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|