C17H16N2O4S — CID 5278696
2-[2-(phenylcarbamothioyloxy)ethylcarbamoyl]benzoic acid (PubChem CID 5278696) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[2-(phenylcarbamothioyloxy)ethylcarbamoyl]benzoic acid.
| Compound Name | 2-[2-(phenylcarbamothioyloxy)ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 5278696 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-[2-(phenylcarbamothioyloxy)ethylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NCCOC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C17H16N2O4S/c20-15(13-8-4-5-9-14(13)16(21)22)18-10-11-23-17(24)19-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,18,20)(H,19,24)(H,21,22) |
| InChIKey | LKZRYYAOPZEOBJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|